C30H31N3O2 — CID 143202801
benzyl 2-[4-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]anilino]-3-(1H-indol-3-yl)propanoate (PubChem CID 143202801) has the molecular formula C30H31N3O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is benzyl 2-[4-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]anilino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | benzyl 2-[4-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]anilino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 143202801 |
| Molecular Formula | C30H31N3O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | benzyl 2-[4-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]anilino]-3-(1H-indol-3-yl)propanoate |
| SMILES | C/C=C\C(=C/C)Nc1ccc(NC(Cc2c[nH]c3ccccc23)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H31N3O2/c1-3-10-24(4-2)32-25-15-17-26(18-16-25)33-29(30(34)35-21-22-11-6-5-7-12-22)19-23-20-31-28-14-9-8-13-27(23)28/h3-18,20,29,31-33H,19,21H2,1-2H3/b10-3-,24-4+ |
| InChIKey | MDCLVXYJERDNJH-IKTCGKRZSA-N |
| XLogP | 6.83 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|