C22H23IN2O2 — CID 177443805
benzyl (2R)-3-(1H-indol-3-yl)-2-[[(E)-2-iodobut-2-enyl]amino]propanoate (PubChem CID 177443805) has the molecular formula C22H23IN2O2 and a molecular weight of 474.34 g/mol. Its IUPAC name is benzyl (2R)-3-(1H-indol-3-yl)-2-[[(E)-2-iodobut-2-enyl]amino]propanoate.
| Compound Name | benzyl (2R)-3-(1H-indol-3-yl)-2-[[(E)-2-iodobut-2-enyl]amino]propanoate |
|---|---|
| PubChem CID | 177443805 |
| Molecular Formula | C22H23IN2O2 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | benzyl (2R)-3-(1H-indol-3-yl)-2-[[(E)-2-iodobut-2-enyl]amino]propanoate |
| SMILES | C/C=C(/I)CN[C@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23IN2O2/c1-2-18(23)14-25-21(22(26)27-15-16-8-4-3-5-9-16)12-17-13-24-20-11-7-6-10-19(17)20/h2-11,13,21,24-25H,12,14-15H2,1H3/b18-2+/t21-/m1/s1 |
| InChIKey | DZGAPVSIGPZQFT-FXNUXSGLSA-N |
| XLogP | 4.75 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|