C26H29F2N5O3 — CID 154647411
N-[(Z)-3-amino-4-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]-2-methylbut-3-en-2-yl]-3,4-difluorobenzamide (PubChem CID 154647411) has the molecular formula C26H29F2N5O3 and a molecular weight of 497.55 g/mol. Its IUPAC name is N-[(Z)-3-amino-4-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]-2-methylbut-3-en-2-yl]-3,4-difluorobenzamide.
| Compound Name | N-[(Z)-3-amino-4-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]-2-methylbut-3-en-2-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 154647411 |
| Molecular Formula | C26H29F2N5O3 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N-[(Z)-3-amino-4-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]-2-methylbut-3-en-2-yl]-3,4-difluorobenzamide |
| SMILES | CC(C)(NC(=O)c1ccc(F)c(F)c1)/C(N)=C/N(N)C(CC(=O)NO)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H29F2N5O3/c1-26(2,31-25(35)19-9-10-21(27)22(28)13-19)23(29)15-33(30)20(14-24(34)32-36)12-16-7-8-17-5-3-4-6-18(17)11-16/h3-11,13,15,20,36H,12,14,29-30H2,1-2H3,(H,31,35)(H,32,34)/b23-15- |
| InChIKey | PGGXCCXLQMENMC-HAHDFKILSA-N |
| XLogP | 3.11 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|