C38H37F2N5O4 — CID 154647483
N-[(Z)-3-amino-4-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]-1-(4-phenylmethoxyphenyl)but-3-en-2-yl]-3,4-difluorobenzamide (PubChem CID 154647483) has the molecular formula C38H37F2N5O4 and a molecular weight of 665.74 g/mol. Its IUPAC name is N-[(Z)-3-amino-4-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]-1-(4-phenylmethoxyphenyl)but-3-en-2-yl]-3,4-difluorobenzamide.
| Compound Name | N-[(Z)-3-amino-4-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]-1-(4-phenylmethoxyphenyl)but-3-en-2-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 154647483 |
| Molecular Formula | C38H37F2N5O4 |
| Molecular Weight | 665.74 g/mol |
| Exact Mass | 665.28 |
| IUPAC Name | N-[(Z)-3-amino-4-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]-1-(4-phenylmethoxyphenyl)but-3-en-2-yl]-3,4-difluorobenzamide |
| SMILES | N/C(=C\N(N)C(CC(=O)NO)Cc1ccc2ccccc2c1)C(Cc1ccc(OCc2ccccc2)cc1)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C38H37F2N5O4/c39-33-17-14-30(21-34(33)40)38(47)43-36(20-25-11-15-32(16-12-25)49-24-26-6-2-1-3-7-26)35(41)23-45(42)31(22-37(46)44-48)19-27-10-13-28-8-4-5-9-29(28)18-27/h1-18,21,23,31,36,48H,19-20,22,24,41-42H2,(H,43,47)(H,44,46)/b35-23- |
| InChIKey | UKXFUNQBKYWFNL-NHYZDEDTSA-N |
| XLogP | 5.52 |
| TPSA | 142.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.74 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|