C23H30N2O2 — CID 176691243
2-[4-(aminomethyl)cyclohexyl]-N-(1-naphthalen-2-yl-3-oxobutan-2-yl)acetamide (PubChem CID 176691243) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[4-(aminomethyl)cyclohexyl]-N-(1-naphthalen-2-yl-3-oxobutan-2-yl)acetamide.
| Compound Name | 2-[4-(aminomethyl)cyclohexyl]-N-(1-naphthalen-2-yl-3-oxobutan-2-yl)acetamide |
|---|---|
| PubChem CID | 176691243 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[4-(aminomethyl)cyclohexyl]-N-(1-naphthalen-2-yl-3-oxobutan-2-yl)acetamide |
| SMILES | CC(=O)C(Cc1ccc2ccccc2c1)NC(=O)CC1CCC(CN)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-16(26)22(13-19-10-11-20-4-2-3-5-21(20)12-19)25-23(27)14-17-6-8-18(15-24)9-7-17/h2-5,10-12,17-18,22H,6-9,13-15,24H2,1H3,(H,25,27) |
| InChIKey | QZXWBLSOOCBVJD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |