About 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide
4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide (PubChem CID 168904062) has the molecular formula C22H30N2O2
and a molecular weight of 354.49 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide |
| PubChem CID | 168904062 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide |
| SMILES | C=Cc1ccc(CC(NC(=O)C2CCC(CN)CC2)C(C)=O)cc1C=C |
| InChI | InChI=1S/C22H30N2O2/c1-4-18-9-8-17(12-19(18)5-2)13-21(15(3)25)24-22(26)20-10-6-16(14-23)7-11-20/h4-5,8-9,12,16,20-21H,1-2,6-7,10-11,13-14,23H2,3H3,(H,24,26) |
| InChIKey | HAFRJYGPULTVNP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide?
The IUPAC name of 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide (CID 168904062) is 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide.
What is the SMILES notation for 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide?
The canonical SMILES for 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide is C=Cc1ccc(CC(NC(=O)C2CCC(CN)CC2)C(C)=O)cc1C=C.
What is the InChIKey of 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide?
The InChIKey is HAFRJYGPULTVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O2/c1-4-18-9-8-17(12-19(18)5-2)13-21(15(3)25)24-22(26)20-10-6-16(14-23)7-11-20/h4-5,8-9,12,16,20-21H,1-2,6-7,10-11,13-14,23H2,3H3,(H,24,26).
What are the key properties of 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide?
4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide has a molecular weight of 354.49 g/mol, XLogP of 3.35, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-N-[1-[3,4-bis(ethenyl)phenyl]-3-oxobutan-2-yl]cyclohexane-1-carboxamide is sourced from PubChem (CID 168904062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).