C14H15Cl2NO2 — CID 142918333
N-[(2R)-1-(2,4-dichlorophenyl)-3-oxobutan-2-yl]cyclopropanecarboxamide (PubChem CID 142918333) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.19 g/mol. Its IUPAC name is N-[(2R)-1-(2,4-dichlorophenyl)-3-oxobutan-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[(2R)-1-(2,4-dichlorophenyl)-3-oxobutan-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 142918333 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-[(2R)-1-(2,4-dichlorophenyl)-3-oxobutan-2-yl]cyclopropanecarboxamide |
| SMILES | CC(=O)[C@@H](Cc1ccc(Cl)cc1Cl)NC(=O)C1CC1 |
| InChI | InChI=1S/C14H15Cl2NO2/c1-8(18)13(17-14(19)9-2-3-9)6-10-4-5-11(15)7-12(10)16/h4-5,7,9,13H,2-3,6H2,1H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | PTSJDGGATVEUBD-CYBMUJFWSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |