C32H54N2O3 — CID 163367484
N-[3-[3,4-bis(ethenyl)phenyl]-1-(5-methylhexylamino)-1-oxopropan-2-yl]-4-ethylcyclohexane-1-carboxamide;ethane;methanol (PubChem CID 163367484) has the molecular formula C32H54N2O3 and a molecular weight of 514.80 g/mol. Its IUPAC name is N-[3-[3,4-bis(ethenyl)phenyl]-1-(5-methylhexylamino)-1-oxopropan-2-yl]-4-ethylcyclohexane-1-carboxamide;ethane;methanol.
| Compound Name | N-[3-[3,4-bis(ethenyl)phenyl]-1-(5-methylhexylamino)-1-oxopropan-2-yl]-4-ethylcyclohexane-1-carboxamide;ethane;methanol |
|---|---|
| PubChem CID | 163367484 |
| Molecular Formula | C32H54N2O3 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.41 |
| IUPAC Name | N-[3-[3,4-bis(ethenyl)phenyl]-1-(5-methylhexylamino)-1-oxopropan-2-yl]-4-ethylcyclohexane-1-carboxamide;ethane;methanol |
| SMILES | C=Cc1ccc(CC(NC(=O)C2CCC(CC)CC2)C(=O)NCCCCC(C)C)cc1C=C.CC.CO |
| InChI | InChI=1S/C29H44N2O2.C2H6.CH4O/c1-6-22-12-16-26(17-13-22)28(32)31-27(29(33)30-18-10-9-11-21(4)5)20-23-14-15-24(7-2)25(8-3)19-23;2*1-2/h7-8,14-15,19,21-22,26-27H,2-3,6,9-13,16-18,20H2,1,4-5H3,(H,30,33)(H,31,32);1-2H3;2H,1H3 |
| InChIKey | IPYMEJHIDIHCQQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|