C20H27N5O — CID 154647557
N-[(Z)-2-amino-3-[amino-(1-amino-3-phenylpropan-2-yl)amino]prop-2-enyl]-4-methylbenzamide (PubChem CID 154647557) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[(Z)-2-amino-3-[amino-(1-amino-3-phenylpropan-2-yl)amino]prop-2-enyl]-4-methylbenzamide.
| Compound Name | N-[(Z)-2-amino-3-[amino-(1-amino-3-phenylpropan-2-yl)amino]prop-2-enyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 154647557 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N-[(Z)-2-amino-3-[amino-(1-amino-3-phenylpropan-2-yl)amino]prop-2-enyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC/C(N)=C/N(N)C(CN)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H27N5O/c1-15-7-9-17(10-8-15)20(26)24-13-18(22)14-25(23)19(12-21)11-16-5-3-2-4-6-16/h2-10,14,19H,11-13,21-23H2,1H3,(H,24,26)/b18-14- |
| InChIKey | OOYBVFLDOHXHHM-JXAWBTAJSA-N |
| XLogP | 1.27 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|