C32H37ClF6N4O5 — CID 158924714
2,2,2-trifluoroethyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate;2,2,2-trifluoroethyl N-[(2S)-1-[(4-methylbenzoyl)amino]-3-phenylpropan-2-yl]carbamate;hydrochloride (PubChem CID 158924714) has the molecular formula C32H37ClF6N4O5 and a molecular weight of 707.11 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate;2,2,2-trifluoroethyl N-[(2S)-1-[(4-methylbenzoyl)amino]-3-phenylpropan-2-yl]carbamate;hydrochloride.
| Compound Name | 2,2,2-trifluoroethyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate;2,2,2-trifluoroethyl N-[(2S)-1-[(4-methylbenzoyl)amino]-3-phenylpropan-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 158924714 |
| Molecular Formula | C32H37ClF6N4O5 |
| Molecular Weight | 707.11 g/mol |
| Exact Mass | 706.24 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate;2,2,2-trifluoroethyl N-[(2S)-1-[(4-methylbenzoyl)amino]-3-phenylpropan-2-yl]carbamate;hydrochloride |
| SMILES | Cc1ccc(C(=O)NC[C@H](Cc2ccccc2)NC(=O)OCC(F)(F)F)cc1.Cl.NC[C@H](Cc1ccccc1)NC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C20H21F3N2O3.C12H15F3N2O2.ClH/c1-14-7-9-16(10-8-14)18(26)24-12-17(11-15-5-3-2-4-6-15)25-19(27)28-13-20(21,22)23;13-12(14,15)8-19-11(18)17-10(7-16)6-9-4-2-1-3-5-9;/h2-10,17H,11-13H2,1H3,(H,24,26)(H,25,27);1-5,10H,6-8,16H2,(H,17,18);1H/t17-;10-;/m00./s1 |
| InChIKey | XVNRUDQYRDJVRG-TWBHEIAKSA-N |
| XLogP | 5.89 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.11 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |