C22H30N6O3 — CID 167210636
4-[4-(3-acetamidophenyl)phenyl]-3-[amino-[(Z)-2-amino-3-(methylamino)prop-1-enyl]amino]-N-hydroxybutanamide (PubChem CID 167210636) has the molecular formula C22H30N6O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-[4-(3-acetamidophenyl)phenyl]-3-[amino-[(Z)-2-amino-3-(methylamino)prop-1-enyl]amino]-N-hydroxybutanamide.
| Compound Name | 4-[4-(3-acetamidophenyl)phenyl]-3-[amino-[(Z)-2-amino-3-(methylamino)prop-1-enyl]amino]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 167210636 |
| Molecular Formula | C22H30N6O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 4-[4-(3-acetamidophenyl)phenyl]-3-[amino-[(Z)-2-amino-3-(methylamino)prop-1-enyl]amino]-N-hydroxybutanamide |
| SMILES | CNC/C(N)=C/N(N)C(CC(=O)NO)Cc1ccc(-c2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C22H30N6O3/c1-15(29)26-20-5-3-4-18(11-20)17-8-6-16(7-9-17)10-21(12-22(30)27-31)28(24)14-19(23)13-25-2/h3-9,11,14,21,25,31H,10,12-13,23-24H2,1-2H3,(H,26,29)(H,27,30)/b19-14- |
| InChIKey | MFZJDSYTENQDOW-RGEXLXHISA-N |
| XLogP | 1.31 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|