C17H15Cl2N3O3 — CID 71888764
N'-(2-amino-2-oxoethyl)-N-[3-(3,4-dichlorophenyl)phenyl]-N'-methyloxamide (PubChem CID 71888764) has the molecular formula C17H15Cl2N3O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is N'-(2-amino-2-oxoethyl)-N-[3-(3,4-dichlorophenyl)phenyl]-N'-methyloxamide.
| Compound Name | N'-(2-amino-2-oxoethyl)-N-[3-(3,4-dichlorophenyl)phenyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 71888764 |
| Molecular Formula | C17H15Cl2N3O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N'-(2-amino-2-oxoethyl)-N-[3-(3,4-dichlorophenyl)phenyl]-N'-methyloxamide |
| SMILES | CN(CC(N)=O)C(=O)C(=O)Nc1cccc(-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H15Cl2N3O3/c1-22(9-15(20)23)17(25)16(24)21-12-4-2-3-10(7-12)11-5-6-13(18)14(19)8-11/h2-8H,9H2,1H3,(H2,20,23)(H,21,24) |
| InChIKey | NIUBIUMSNYPFJP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|