C25H26N2O5S — CID 57271142
5-(1H-indol-3-yl)-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]pentanoic acid (PubChem CID 57271142) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is 5-(1H-indol-3-yl)-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]pentanoic acid.
| Compound Name | 5-(1H-indol-3-yl)-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 57271142 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 5-(1H-indol-3-yl)-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]pentanoic acid |
| SMILES | O=C(O)C(CCCc1c[nH]c2ccccc12)N(c1ccc2c3c(oc2c1)CCCC3)S(=O)O |
| InChI | InChI=1S/C25H26N2O5S/c28-25(29)22(10-5-6-16-15-26-21-9-3-1-7-18(16)21)27(33(30)31)17-12-13-20-19-8-2-4-11-23(19)32-24(20)14-17/h1,3,7,9,12-15,22,26H,2,4-6,8,10-11H2,(H,28,29)(H,30,31) |
| InChIKey | NKKOIDSAWLNMIV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|