C27H30N2O5S — CID 57277496
7-(1H-indol-3-yl)-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]heptanoic acid (PubChem CID 57277496) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is 7-(1H-indol-3-yl)-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]heptanoic acid.
| Compound Name | 7-(1H-indol-3-yl)-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]heptanoic acid |
|---|---|
| PubChem CID | 57277496 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 7-(1H-indol-3-yl)-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]heptanoic acid |
| SMILES | O=C(O)C(CCCCCc1c[nH]c2ccccc12)N(c1ccc2c3c(oc2c1)CCCC3)S(=O)O |
| InChI | InChI=1S/C27H30N2O5S/c30-27(31)24(12-3-1-2-8-18-17-28-23-11-6-4-9-20(18)23)29(35(32)33)19-14-15-22-21-10-5-7-13-25(21)34-26(22)16-19/h4,6,9,11,14-17,24,28H,1-3,5,7-8,10,12-13H2,(H,30,31)(H,32,33) |
| InChIKey | VFVRGTJKIDPMOK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|