C24H24N2O3 — CID 21243262
3-[4-(3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-2-yl)butyl]-1H-indole-4-carboxylic acid (PubChem CID 21243262) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[4-(3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-2-yl)butyl]-1H-indole-4-carboxylic acid.
| Compound Name | 3-[4-(3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-2-yl)butyl]-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 21243262 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-[4-(3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-2-yl)butyl]-1H-indole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2[nH]cc(CCCCN3CCc4c(oc5ccccc45)C3)c12 |
| InChI | InChI=1S/C24H24N2O3/c27-24(28)19-8-5-9-20-23(19)16(14-25-20)6-3-4-12-26-13-11-18-17-7-1-2-10-21(17)29-22(18)15-26/h1-2,5,7-10,14,25H,3-4,6,11-13,15H2,(H,27,28) |
| InChIKey | YPUZJGHKWJROBA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|