C24H24N2O2S — CID 21243328
3-[4-(3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridin-2-yl)butyl]-1H-indole-5-carboxylic acid (PubChem CID 21243328) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 3-[4-(3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridin-2-yl)butyl]-1H-indole-5-carboxylic acid.
| Compound Name | 3-[4-(3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridin-2-yl)butyl]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 21243328 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-[4-(3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridin-2-yl)butyl]-1H-indole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]cc(CCCCN3CCc4c(sc5ccccc45)C3)c2c1 |
| InChI | InChI=1S/C24H24N2O2S/c27-24(28)16-8-9-21-20(13-16)17(14-25-21)5-3-4-11-26-12-10-19-18-6-1-2-7-22(18)29-23(19)15-26/h1-2,6-9,13-14,25H,3-5,10-12,15H2,(H,27,28) |
| InChIKey | FXONZSZCDUWYNV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|