C32H42N2O5 — CID 21419601
1,3-bis(4-piperidin-1-ylbutyl)dibenzofuran-2,6-dicarboxylic acid (PubChem CID 21419601) has the molecular formula C32H42N2O5 and a molecular weight of 534.70 g/mol. Its IUPAC name is 1,3-bis(4-piperidin-1-ylbutyl)dibenzofuran-2,6-dicarboxylic acid.
| Compound Name | 1,3-bis(4-piperidin-1-ylbutyl)dibenzofuran-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 21419601 |
| Molecular Formula | C32H42N2O5 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 1,3-bis(4-piperidin-1-ylbutyl)dibenzofuran-2,6-dicarboxylic acid |
| SMILES | O=C(O)c1c(CCCCN2CCCCC2)cc2oc3c(C(=O)O)cccc3c2c1CCCCN1CCCCC1 |
| InChI | InChI=1S/C32H42N2O5/c35-31(36)26-15-11-14-25-29-24(13-4-10-21-34-18-7-2-8-19-34)28(32(37)38)23(22-27(29)39-30(25)26)12-3-9-20-33-16-5-1-6-17-33/h11,14-15,22H,1-10,12-13,16-21H2,(H,35,36)(H,37,38) |
| InChIKey | UNNQQVZCUZEELV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|