C23H24N2O2S — CID 21243271
2-[4-(1H-indol-3-yl)butyl]-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridine 9,9-dioxide (PubChem CID 21243271) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-yl)butyl]-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridine 9,9-dioxide.
| Compound Name | 2-[4-(1H-indol-3-yl)butyl]-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridine 9,9-dioxide |
|---|---|
| PubChem CID | 21243271 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[4-(1H-indol-3-yl)butyl]-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridine 9,9-dioxide |
| SMILES | O=S1(=O)C2=C(CCN(CCCCc3c[nH]c4ccccc34)C2)c2ccccc21 |
| InChI | InChI=1S/C23H24N2O2S/c26-28(27)22-11-4-2-9-19(22)20-12-14-25(16-23(20)28)13-6-5-7-17-15-24-21-10-3-1-8-18(17)21/h1-4,8-11,15,24H,5-7,12-14,16H2 |
| InChIKey | IACVZZKLOPHLEZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|