C25H28N2O2 — CID 21243324
2-[4-[7-(hydroxymethyl)-1H-indol-3-yl]butyl]-1,3,4,9-tetrahydroindeno[2,3-c]pyridin-9-ol (PubChem CID 21243324) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[4-[7-(hydroxymethyl)-1H-indol-3-yl]butyl]-1,3,4,9-tetrahydroindeno[2,3-c]pyridin-9-ol.
| Compound Name | 2-[4-[7-(hydroxymethyl)-1H-indol-3-yl]butyl]-1,3,4,9-tetrahydroindeno[2,3-c]pyridin-9-ol |
|---|---|
| PubChem CID | 21243324 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[4-[7-(hydroxymethyl)-1H-indol-3-yl]butyl]-1,3,4,9-tetrahydroindeno[2,3-c]pyridin-9-ol |
| SMILES | OCc1cccc2c(CCCCN3CCC4=C(C3)C(O)c3ccccc34)c[nH]c12 |
| InChI | InChI=1S/C25H28N2O2/c28-16-18-7-5-10-19-17(14-26-24(18)19)6-3-4-12-27-13-11-21-20-8-1-2-9-22(20)25(29)23(21)15-27/h1-2,5,7-10,14,25-26,28-29H,3-4,6,11-13,15-16H2 |
| InChIKey | WOZRRLWELQIXQS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|