C24H26N2O2S — CID 54340649
2-[3-[4-(hydroxymethyl)-1H-indol-3-yl]propylsulfanyl]-1,3,4,9-tetrahydroindeno[2,3-c]pyridin-9-ol (PubChem CID 54340649) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-[3-[4-(hydroxymethyl)-1H-indol-3-yl]propylsulfanyl]-1,3,4,9-tetrahydroindeno[2,3-c]pyridin-9-ol.
| Compound Name | 2-[3-[4-(hydroxymethyl)-1H-indol-3-yl]propylsulfanyl]-1,3,4,9-tetrahydroindeno[2,3-c]pyridin-9-ol |
|---|---|
| PubChem CID | 54340649 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[3-[4-(hydroxymethyl)-1H-indol-3-yl]propylsulfanyl]-1,3,4,9-tetrahydroindeno[2,3-c]pyridin-9-ol |
| SMILES | OCc1cccc2[nH]cc(CCCSN3CCC4=C(C3)C(O)c3ccccc34)c12 |
| InChI | InChI=1S/C24H26N2O2S/c27-15-17-5-3-9-22-23(17)16(13-25-22)6-4-12-29-26-11-10-19-18-7-1-2-8-20(18)24(28)21(19)14-26/h1-3,5,7-9,13,24-25,27-28H,4,6,10-12,14-15H2 |
| InChIKey | TYRVUSKDDGWTLE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|