C23H26N2OS — CID 19786779
[3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indol-4-yl]methanol (PubChem CID 19786779) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is [3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indol-4-yl]methanol.
| Compound Name | [3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indol-4-yl]methanol |
|---|---|
| PubChem CID | 19786779 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indol-4-yl]methanol |
| SMILES | OCc1cccc2[nH]cc(CSCCC3CC(c4ccccc4)=CCN3)c12 |
| InChI | InChI=1S/C23H26N2OS/c26-15-19-7-4-8-22-23(19)20(14-25-22)16-27-12-10-21-13-18(9-11-24-21)17-5-2-1-3-6-17/h1-9,14,21,24-26H,10-13,15-16H2 |
| InChIKey | RIRSTIIWDYMUMY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|