C25H28N2O3 — CID 70412488
[3-[5-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)pentyl]-1H-indol-5-yl] hydrogen carbonate (PubChem CID 70412488) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is [3-[5-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)pentyl]-1H-indol-5-yl] hydrogen carbonate.
| Compound Name | [3-[5-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)pentyl]-1H-indol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70412488 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | [3-[5-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)pentyl]-1H-indol-5-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2[nH]cc(CCCCCC3CC(c4ccccc4)=CCN3)c2c1 |
| InChI | InChI=1S/C25H28N2O3/c28-25(29)30-22-11-12-24-23(16-22)20(17-27-24)9-5-2-6-10-21-15-19(13-14-26-21)18-7-3-1-4-8-18/h1,3-4,7-8,11-13,16-17,21,26-27H,2,5-6,9-10,14-15H2,(H,28,29) |
| InChIKey | SECMZDIBYBGQAV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|