C21H24N2OS — CID 19848882
3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-ol (PubChem CID 19848882) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is 3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-ol.
| Compound Name | 3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-ol |
|---|---|
| PubChem CID | 19848882 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-ol |
| SMILES | Oc1ccc2c(CCCCC3CC(c4cccs4)=CCN3)c[nH]c2c1 |
| InChI | InChI=1S/C21H24N2OS/c24-18-7-8-19-16(14-23-20(19)13-18)4-1-2-5-17-12-15(9-10-22-17)21-6-3-11-25-21/h3,6-9,11,13-14,17,22-24H,1-2,4-5,10,12H2 |
| InChIKey | JAMKUJVJAGYXDQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|