C14H14N2S — CID 82293447
2-(6-thiophen-2-yl-1H-indol-3-yl)ethanamine (PubChem CID 82293447) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-(6-thiophen-2-yl-1H-indol-3-yl)ethanamine.
| Compound Name | 2-(6-thiophen-2-yl-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 82293447 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-(6-thiophen-2-yl-1H-indol-3-yl)ethanamine |
| SMILES | NCCc1c[nH]c2cc(-c3cccs3)ccc12 |
| InChI | InChI=1S/C14H14N2S/c15-6-5-11-9-16-13-8-10(3-4-12(11)13)14-2-1-7-17-14/h1-4,7-9,16H,5-6,15H2 |
| InChIKey | AAIITMSDLOBYKV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |