C20H22N2S2 — CID 19848959
3-[2-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indole (PubChem CID 19848959) has the molecular formula C20H22N2S2 and a molecular weight of 354.54 g/mol. Its IUPAC name is 3-[2-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indole.
| Compound Name | 3-[2-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indole |
|---|---|
| PubChem CID | 19848959 |
| Molecular Formula | C20H22N2S2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-[2-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indole |
| SMILES | C1=C(c2cccs2)CC(CCSCc2c[nH]c3ccccc23)NC1 |
| InChI | InChI=1S/C20H22N2S2/c1-2-5-19-18(4-1)16(13-22-19)14-23-11-8-17-12-15(7-9-21-17)20-6-3-10-24-20/h1-7,10,13,17,21-22H,8-9,11-12,14H2 |
| InChIKey | VGTDRAKEIYWCNK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|