C24H26N2O2 — CID 54353975
7-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-5H-[1,3]dioxolo[4,5-f]indole (PubChem CID 54353975) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 7-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-5H-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 7-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-5H-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 54353975 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 7-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-5H-[1,3]dioxolo[4,5-f]indole |
| SMILES | C1=C(c2ccccc2)CC(CCCCc2c[nH]c3cc4c(cc23)OCO4)NC1 |
| InChI | InChI=1S/C24H26N2O2/c1-2-6-17(7-3-1)18-10-11-25-20(12-18)9-5-4-8-19-15-26-22-14-24-23(13-21(19)22)27-16-28-24/h1-3,6-7,10,13-15,20,25-26H,4-5,8-9,11-12,16H2 |
| InChIKey | UHUGHQFOGXRVRF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|