C25H29ClN2O3 — CID 67883034
5-methoxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-6-carboxylic acid;hydrochloride (PubChem CID 67883034) has the molecular formula C25H29ClN2O3 and a molecular weight of 440.97 g/mol. Its IUPAC name is 5-methoxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-6-carboxylic acid;hydrochloride.
| Compound Name | 5-methoxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-6-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67883034 |
| Molecular Formula | C25H29ClN2O3 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 5-methoxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-6-carboxylic acid;hydrochloride |
| SMILES | COc1cc2c(CCCCC3CC(c4ccccc4)=CCN3)c[nH]c2cc1C(=O)O.Cl |
| InChI | InChI=1S/C25H28N2O3.ClH/c1-30-24-15-21-19(16-27-23(21)14-22(24)25(28)29)9-5-6-10-20-13-18(11-12-26-20)17-7-3-2-4-8-17;/h2-4,7-8,11,14-16,20,26-27H,5-6,9-10,12-13H2,1H3,(H,28,29);1H |
| InChIKey | DNURDKZQMAQIEK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|