C27H32N2O4 — CID 70412162
ethyl [5-methoxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-yl] carbonate (PubChem CID 70412162) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is ethyl [5-methoxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-yl] carbonate.
| Compound Name | ethyl [5-methoxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-yl] carbonate |
|---|---|
| PubChem CID | 70412162 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | ethyl [5-methoxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-yl] carbonate |
| SMILES | CCOC(=O)Oc1cc2[nH]cc(CCCCC3CC(c4ccccc4)=CCN3)c2cc1OC |
| InChI | InChI=1S/C27H32N2O4/c1-3-32-27(30)33-26-17-24-23(16-25(26)31-2)21(18-29-24)11-7-8-12-22-15-20(13-14-28-22)19-9-5-4-6-10-19/h4-6,9-10,13,16-18,22,28-29H,3,7-8,11-12,14-15H2,1-2H3 |
| InChIKey | QECYKKQAXIJACP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|