C26H30N2O4 — CID 70412498
ethyl [5-hydroxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-yl] carbonate (PubChem CID 70412498) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is ethyl [5-hydroxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-yl] carbonate.
| Compound Name | ethyl [5-hydroxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-yl] carbonate |
|---|---|
| PubChem CID | 70412498 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | ethyl [5-hydroxy-3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indol-6-yl] carbonate |
| SMILES | CCOC(=O)Oc1cc2[nH]cc(CCCCC3CC(c4ccccc4)=CCN3)c2cc1O |
| InChI | InChI=1S/C26H30N2O4/c1-2-31-26(30)32-25-16-23-22(15-24(25)29)20(17-28-23)10-6-7-11-21-14-19(12-13-27-21)18-8-4-3-5-9-18/h3-5,8-9,12,15-17,21,27-29H,2,6-7,10-11,13-14H2,1H3 |
| InChIKey | XEWODCOPPBHOAI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|