C21H22Cl2N2S — CID 19848911
5,6-dichloro-3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole (PubChem CID 19848911) has the molecular formula C21H22Cl2N2S and a molecular weight of 405.39 g/mol. Its IUPAC name is 5,6-dichloro-3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole.
| Compound Name | 5,6-dichloro-3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole |
|---|---|
| PubChem CID | 19848911 |
| Molecular Formula | C21H22Cl2N2S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 5,6-dichloro-3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole |
| SMILES | Clc1cc2[nH]cc(CCCCC3CC(c4cccs4)=CCN3)c2cc1Cl |
| InChI | InChI=1S/C21H22Cl2N2S/c22-18-11-17-15(13-25-20(17)12-19(18)23)4-1-2-5-16-10-14(7-8-24-16)21-6-3-9-26-21/h3,6-7,9,11-13,16,24-25H,1-2,4-5,8,10H2 |
| InChIKey | GGSGZZRVQNLAHP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|