C24H27N3O — CID 19786689
3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-7-carboxamide (PubChem CID 19786689) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-7-carboxamide.
| Compound Name | 3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 19786689 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 3-[4-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cccc2c(CCCCC3CC(c4ccccc4)=CCN3)c[nH]c12 |
| InChI | InChI=1S/C24H27N3O/c25-24(28)22-12-6-11-21-19(16-27-23(21)22)9-4-5-10-20-15-18(13-14-26-20)17-7-2-1-3-8-17/h1-3,6-8,11-13,16,20,26-27H,4-5,9-10,14-15H2,(H2,25,28) |
| InChIKey | PXTGCSMELSFFJV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|