C24H25ClN2O2S — CID 19786774
methyl 7-chloro-3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indole-4-carboxylate (PubChem CID 19786774) has the molecular formula C24H25ClN2O2S and a molecular weight of 441.00 g/mol. Its IUPAC name is methyl 7-chloro-3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indole-4-carboxylate.
| Compound Name | methyl 7-chloro-3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indole-4-carboxylate |
|---|---|
| PubChem CID | 19786774 |
| Molecular Formula | C24H25ClN2O2S |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | methyl 7-chloro-3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indole-4-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)c2[nH]cc(CSCCC3CC(c4ccccc4)=CCN3)c12 |
| InChI | InChI=1S/C24H25ClN2O2S/c1-29-24(28)20-7-8-21(25)23-22(20)18(14-27-23)15-30-12-10-19-13-17(9-11-26-19)16-5-3-2-4-6-16/h2-9,14,19,26-27H,10-13,15H2,1H3 |
| InChIKey | RXHSSKZSFQAUIA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|