C24H26N2O2S — CID 67883073
methyl 3-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethylsulfanylmethyl]-1H-indole-7-carboxylate (PubChem CID 67883073) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is methyl 3-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethylsulfanylmethyl]-1H-indole-7-carboxylate.
| Compound Name | methyl 3-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethylsulfanylmethyl]-1H-indole-7-carboxylate |
|---|---|
| PubChem CID | 67883073 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | methyl 3-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethylsulfanylmethyl]-1H-indole-7-carboxylate |
| SMILES | COC(=O)c1cccc2c(CSCCN3CC=C(c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C24H26N2O2S/c1-28-24(27)22-9-5-8-21-20(16-25-23(21)22)17-29-15-14-26-12-10-19(11-13-26)18-6-3-2-4-7-18/h2-10,16,25H,11-15,17H2,1H3 |
| InChIKey | SUIHHHLRLMCANF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|