C23H25N3O2S — CID 57168776
3-[2-[4-(3-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethylsulfanylmethyl]-1H-indole-5-carboxamide (PubChem CID 57168776) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 3-[2-[4-(3-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethylsulfanylmethyl]-1H-indole-5-carboxamide.
| Compound Name | 3-[2-[4-(3-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethylsulfanylmethyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 57168776 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 3-[2-[4-(3-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethylsulfanylmethyl]-1H-indole-5-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]cc(CSCCN3CC=C(c4cccc(O)c4)CC3)c2c1 |
| InChI | InChI=1S/C23H25N3O2S/c24-23(28)18-4-5-22-21(13-18)19(14-25-22)15-29-11-10-26-8-6-16(7-9-26)17-2-1-3-20(27)12-17/h1-6,12-14,25,27H,7-11,15H2,(H2,24,28) |
| InChIKey | ZBOQCRXQQRJLOU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|