C26H32N2OS — CID 57241611
3-[2-[4-(4-butoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethylsulfanylmethyl]-1H-indole (PubChem CID 57241611) has the molecular formula C26H32N2OS and a molecular weight of 420.62 g/mol. Its IUPAC name is 3-[2-[4-(4-butoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethylsulfanylmethyl]-1H-indole.
| Compound Name | 3-[2-[4-(4-butoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethylsulfanylmethyl]-1H-indole |
|---|---|
| PubChem CID | 57241611 |
| Molecular Formula | C26H32N2OS |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-[2-[4-(4-butoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethylsulfanylmethyl]-1H-indole |
| SMILES | CCCCOc1ccc(C2=CCN(CCSCc3c[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C26H32N2OS/c1-2-3-17-29-24-10-8-21(9-11-24)22-12-14-28(15-13-22)16-18-30-20-23-19-27-26-7-5-4-6-25(23)26/h4-12,19,27H,2-3,13-18,20H2,1H3 |
| InChIKey | DOGZAKGAMVHDSO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|