C23H26Cl2N2 — CID 10386307
3-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole;hydrochloride (PubChem CID 10386307) has the molecular formula C23H26Cl2N2 and a molecular weight of 401.38 g/mol. Its IUPAC name is 3-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole;hydrochloride.
| Compound Name | 3-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole;hydrochloride |
|---|---|
| PubChem CID | 10386307 |
| Molecular Formula | C23H26Cl2N2 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole;hydrochloride |
| SMILES | Cl.Clc1ccc(C2=CCN(CCCCc3c[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C23H25ClN2.ClH/c24-21-10-8-18(9-11-21)19-12-15-26(16-13-19)14-4-3-5-20-17-25-23-7-2-1-6-22(20)23;/h1-2,6-12,17,25H,3-5,13-16H2;1H |
| InChIKey | CQIVJXIPGYMOJP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|