C28H30ClN3 — CID 92650578
3-[3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propyl]-1H-indole (PubChem CID 92650578) has the molecular formula C28H30ClN3 and a molecular weight of 444.02 g/mol. Its IUPAC name is 3-[3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propyl]-1H-indole.
| Compound Name | 3-[3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propyl]-1H-indole |
|---|---|
| PubChem CID | 92650578 |
| Molecular Formula | C28H30ClN3 |
| Molecular Weight | 444.02 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 3-[3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propyl]-1H-indole |
| SMILES | Clc1ccc([C@@H](c2ccccc2)N2CCN(CCCc3c[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C28H30ClN3/c29-25-14-12-23(13-15-25)28(22-7-2-1-3-8-22)32-19-17-31(18-20-32)16-6-9-24-21-30-27-11-5-4-10-26(24)27/h1-5,7-8,10-15,21,28,30H,6,9,16-20H2/t28-/m1/s1 |
| InChIKey | MDHWZXAVBYFNDP-MUUNZHRXSA-N |
| XLogP | 6.16 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.02 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |