C20H21ClN2S2 — CID 57090022
5-chloro-3-[2-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)ethylsulfanylmethyl]-1H-indole (PubChem CID 57090022) has the molecular formula C20H21ClN2S2 and a molecular weight of 388.99 g/mol. Its IUPAC name is 5-chloro-3-[2-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)ethylsulfanylmethyl]-1H-indole.
| Compound Name | 5-chloro-3-[2-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)ethylsulfanylmethyl]-1H-indole |
|---|---|
| PubChem CID | 57090022 |
| Molecular Formula | C20H21ClN2S2 |
| Molecular Weight | 388.99 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 5-chloro-3-[2-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)ethylsulfanylmethyl]-1H-indole |
| SMILES | Clc1ccc2[nH]cc(CSCCN3CC=C(c4cccs4)CC3)c2c1 |
| InChI | InChI=1S/C20H21ClN2S2/c21-17-3-4-19-18(12-17)16(13-22-19)14-24-11-9-23-7-5-15(6-8-23)20-2-1-10-25-20/h1-5,10,12-13,22H,6-9,11,14H2 |
| InChIKey | OXNNGDQYYZJOPE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|