C26H24ClN3S — CID 57020416
3-[3-[4-(5-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]propyl]-2-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (PubChem CID 57020416) has the molecular formula C26H24ClN3S and a molecular weight of 446.02 g/mol. Its IUPAC name is 3-[3-[4-(5-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]propyl]-2-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene.
| Compound Name | 3-[3-[4-(5-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]propyl]-2-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 57020416 |
| Molecular Formula | C26H24ClN3S |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 3-[3-[4-(5-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]propyl]-2-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| SMILES | Clc1ccc2[nH]cc(C3=CCN(CCCN4Sc5cccc6cccc4c56)CC3)c2c1 |
| InChI | InChI=1S/C26H24ClN3S/c27-20-8-9-23-21(16-20)22(17-28-23)18-10-14-29(15-11-18)12-3-13-30-24-6-1-4-19-5-2-7-25(31-30)26(19)24/h1-2,4-10,16-17,28H,3,11-15H2 |
| InChIKey | FDPKZRQOJVZLAQ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|