C27H30ClN3O — CID 18545791
1-[3-[4-[4-(6-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 18545791) has the molecular formula C27H30ClN3O and a molecular weight of 448.01 g/mol. Its IUPAC name is 1-[3-[4-[4-(6-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[3-[4-[4-(6-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 18545791 |
| Molecular Formula | C27H30ClN3O |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-[3-[4-[4-(6-chloro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CC(CCCCN2CC=C(c3c[nH]c4cc(Cl)ccc34)CC2)c2ccccc21 |
| InChI | InChI=1S/C27H30ClN3O/c1-19(32)31-18-21(23-7-2-3-8-27(23)31)6-4-5-13-30-14-11-20(12-15-30)25-17-29-26-16-22(28)9-10-24(25)26/h2-3,7-11,16-17,21,29H,4-6,12-15,18H2,1H3 |
| InChIKey | PZSWVAZWLTZBOP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|