C21H22N2O — CID 70483927
4-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1H-indol-6-ol (PubChem CID 70483927) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1H-indol-6-ol.
| Compound Name | 4-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1H-indol-6-ol |
|---|---|
| PubChem CID | 70483927 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1H-indol-6-ol |
| SMILES | Oc1cc(CCN2CC=C(c3ccccc3)CC2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C21H22N2O/c24-19-14-18(20-6-10-22-21(20)15-19)9-13-23-11-7-17(8-12-23)16-4-2-1-3-5-16/h1-7,10,14-15,22,24H,8-9,11-13H2 |
| InChIKey | JIWDOWRLHHPWLY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |