C24H29N3O3 — CID 19092298
methyl 4-amino-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butylcarbamoyl]benzoate (PubChem CID 19092298) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is methyl 4-amino-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butylcarbamoyl]benzoate.
| Compound Name | methyl 4-amino-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 19092298 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | methyl 4-amino-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(N)c(C(=O)NCCCCN2CC=C(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H29N3O3/c1-30-24(29)20-9-10-22(25)21(17-20)23(28)26-13-5-6-14-27-15-11-19(12-16-27)18-7-3-2-4-8-18/h2-4,7-11,17H,5-6,12-16,25H2,1H3,(H,26,28) |
| InChIKey | ZTDZGLFAOUOWRZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|