C27H34N2O5 — CID 19087699
methyl 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-4-methoxybenzoate (PubChem CID 19087699) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is methyl 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-4-methoxybenzoate.
| Compound Name | methyl 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 19087699 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | methyl 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-4-methoxybenzoate |
| SMILES | CCOC(=O)N(CCCCN1CC=C(c2ccccc2)CC1)c1cc(OC)ccc1C(=O)OC |
| InChI | InChI=1S/C27H34N2O5/c1-4-34-27(31)29(25-20-23(32-2)12-13-24(25)26(30)33-3)17-9-8-16-28-18-14-22(15-19-28)21-10-6-5-7-11-21/h5-7,10-14,20H,4,8-9,15-19H2,1-3H3 |
| InChIKey | OKBYNWHXKFFHRI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|