C26H31N3O6 — CID 139881375
methyl 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-5-nitrobenzoate (PubChem CID 139881375) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is methyl 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-5-nitrobenzoate.
| Compound Name | methyl 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-5-nitrobenzoate |
|---|---|
| PubChem CID | 139881375 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | methyl 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-5-nitrobenzoate |
| SMILES | CCOC(=O)N(CCCCN1CC=C(c2ccccc2)CC1)c1ccc([N+](=O)[O-])cc1C(=O)OC |
| InChI | InChI=1S/C26H31N3O6/c1-3-35-26(31)28(24-12-11-22(29(32)33)19-23(24)25(30)34-2)16-8-7-15-27-17-13-21(14-18-27)20-9-5-4-6-10-20/h4-6,9-13,19H,3,7-8,14-18H2,1-2H3 |
| InChIKey | NVMGUVIGTYTALW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|