C25H30ClN3O3 — CID 19087680
ethyl N-(2-carbamoyl-5-chlorophenyl)-N-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]carbamate (PubChem CID 19087680) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is ethyl N-(2-carbamoyl-5-chlorophenyl)-N-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]carbamate.
| Compound Name | ethyl N-(2-carbamoyl-5-chlorophenyl)-N-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]carbamate |
|---|---|
| PubChem CID | 19087680 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | ethyl N-(2-carbamoyl-5-chlorophenyl)-N-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]carbamate |
| SMILES | CCOC(=O)N(CCCCN1CC=C(c2ccccc2)CC1)c1cc(Cl)ccc1C(N)=O |
| InChI | InChI=1S/C25H30ClN3O3/c1-2-32-25(31)29(23-18-21(26)10-11-22(23)24(27)30)15-7-6-14-28-16-12-20(13-17-28)19-8-4-3-5-9-19/h3-5,8-12,18H,2,6-7,13-17H2,1H3,(H2,27,30) |
| InChIKey | BWMIAIYWSAHOOT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|