C23H24N2O3S — CID 70412998
[3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indol-7-yl] hydrogen carbonate (PubChem CID 70412998) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is [3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indol-7-yl] hydrogen carbonate.
| Compound Name | [3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indol-7-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70412998 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [3-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)ethylsulfanylmethyl]-1H-indol-7-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cccc2c(CSCCC3CC(c4ccccc4)=CCN3)c[nH]c12 |
| InChI | InChI=1S/C23H24N2O3S/c26-23(27)28-21-8-4-7-20-18(14-25-22(20)21)15-29-12-10-19-13-17(9-11-24-19)16-5-2-1-3-6-16/h1-9,14,19,24-25H,10-13,15H2,(H,26,27) |
| InChIKey | CXUVVEXBWHPTTN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|