C25H30N2O3 — CID 70064532
[3-[4-(3-benzylpiperidin-1-yl)butyl]-1H-indol-5-yl] hydrogen carbonate (PubChem CID 70064532) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is [3-[4-(3-benzylpiperidin-1-yl)butyl]-1H-indol-5-yl] hydrogen carbonate.
| Compound Name | [3-[4-(3-benzylpiperidin-1-yl)butyl]-1H-indol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70064532 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [3-[4-(3-benzylpiperidin-1-yl)butyl]-1H-indol-5-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2[nH]cc(CCCCN3CCCC(Cc4ccccc4)C3)c2c1 |
| InChI | InChI=1S/C25H30N2O3/c28-25(29)30-22-11-12-24-23(16-22)21(17-26-24)10-4-5-13-27-14-6-9-20(18-27)15-19-7-2-1-3-8-19/h1-3,7-8,11-12,16-17,20,26H,4-6,9-10,13-15,18H2,(H,28,29) |
| InChIKey | MNJKETBBPKHVGH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|