C24H28Cl2N4O3 — CID 67617990
[3-[4-[4-(3,5-dichloro-4-methoxyphenyl)piperazin-1-yl]butyl]-1H-indol-5-yl] carbamate (PubChem CID 67617990) has the molecular formula C24H28Cl2N4O3 and a molecular weight of 491.42 g/mol. Its IUPAC name is [3-[4-[4-(3,5-dichloro-4-methoxyphenyl)piperazin-1-yl]butyl]-1H-indol-5-yl] carbamate.
| Compound Name | [3-[4-[4-(3,5-dichloro-4-methoxyphenyl)piperazin-1-yl]butyl]-1H-indol-5-yl] carbamate |
|---|---|
| PubChem CID | 67617990 |
| Molecular Formula | C24H28Cl2N4O3 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | [3-[4-[4-(3,5-dichloro-4-methoxyphenyl)piperazin-1-yl]butyl]-1H-indol-5-yl] carbamate |
| SMILES | COc1c(Cl)cc(N2CCN(CCCCc3c[nH]c4ccc(OC(N)=O)cc34)CC2)cc1Cl |
| InChI | InChI=1S/C24H28Cl2N4O3/c1-32-23-20(25)12-17(13-21(23)26)30-10-8-29(9-11-30)7-3-2-4-16-15-28-22-6-5-18(14-19(16)22)33-24(27)31/h5-6,12-15,28H,2-4,7-11H2,1H3,(H2,27,31) |
| InChIKey | WWQLLNVTYMGVBN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|