C28H32ClN5O3 — CID 118499189
5-chloro-3-[4-[4-[4-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]piperazin-1-yl]butyl]-1H-indole (PubChem CID 118499189) has the molecular formula C28H32ClN5O3 and a molecular weight of 522.05 g/mol. Its IUPAC name is 5-chloro-3-[4-[4-[4-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]piperazin-1-yl]butyl]-1H-indole.
| Compound Name | 5-chloro-3-[4-[4-[4-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]piperazin-1-yl]butyl]-1H-indole |
|---|---|
| PubChem CID | 118499189 |
| Molecular Formula | C28H32ClN5O3 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 5-chloro-3-[4-[4-[4-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]piperazin-1-yl]butyl]-1H-indole |
| SMILES | COc1cc(OC)nc(Oc2ccc(N3CCN(CCCCc4c[nH]c5ccc(Cl)cc45)CC3)cc2)n1 |
| InChI | InChI=1S/C28H32ClN5O3/c1-35-26-18-27(36-2)32-28(31-26)37-23-9-7-22(8-10-23)34-15-13-33(14-16-34)12-4-3-5-20-19-30-25-11-6-21(29)17-24(20)25/h6-11,17-19,30H,3-5,12-16H2,1-2H3 |
| InChIKey | ZOUMCDSIAHOYPS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|