C23H28N2O2 — CID 70044177
3-[4-[3-(3-hydroxyphenyl)piperidin-1-yl]butyl]-1H-indol-5-ol (PubChem CID 70044177) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[4-[3-(3-hydroxyphenyl)piperidin-1-yl]butyl]-1H-indol-5-ol.
| Compound Name | 3-[4-[3-(3-hydroxyphenyl)piperidin-1-yl]butyl]-1H-indol-5-ol |
|---|---|
| PubChem CID | 70044177 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3-[4-[3-(3-hydroxyphenyl)piperidin-1-yl]butyl]-1H-indol-5-ol |
| SMILES | Oc1cccc(C2CCCN(CCCCc3c[nH]c4ccc(O)cc34)C2)c1 |
| InChI | InChI=1S/C23H28N2O2/c26-20-8-3-6-17(13-20)19-7-4-12-25(16-19)11-2-1-5-18-15-24-23-10-9-21(27)14-22(18)23/h3,6,8-10,13-15,19,24,26-27H,1-2,4-5,7,11-12,16H2 |
| InChIKey | OGLPBXFTLIDYBY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|